C23H22Br2N4O6 — CID 126331438
ethyl 2-[2-bromo-4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetate (PubChem CID 126331438) has the molecular formula C23H22Br2N4O6 and a molecular weight of 610.26 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 126331438 |
| Molecular Formula | C23H22Br2N4O6 |
| Molecular Weight | 610.26 g/mol |
| Exact Mass | 607.99 |
| IUPAC Name | ethyl 2-[2-bromo-4-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetate |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)c(OCC(=O)OCC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22Br2N4O6/c1-3-5-6-20-27-18-8-7-15(24)11-16(18)23(31)28(20)26-12-14-9-17(25)22(19(10-14)29(32)33)35-13-21(30)34-4-2/h7-12H,3-6,13H2,1-2H3 |
| InChIKey | XPBFZNWCTHFBLR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|