C28H28BrN3O4 — CID 126332204
ethyl (2R)-2-[1-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]naphthalen-2-yl]oxypropanoate (PubChem CID 126332204) has the molecular formula C28H28BrN3O4 and a molecular weight of 550.45 g/mol. Its IUPAC name is ethyl (2R)-2-[1-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]naphthalen-2-yl]oxypropanoate.
| Compound Name | ethyl (2R)-2-[1-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]naphthalen-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 126332204 |
| Molecular Formula | C28H28BrN3O4 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | ethyl (2R)-2-[1-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]naphthalen-2-yl]oxypropanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc2ccccc2c1C=Nn1c([C@@H](C)CC)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C28H28BrN3O4/c1-5-17(3)26-31-24-13-12-20(29)15-22(24)27(33)32(26)30-16-23-21-10-8-7-9-19(21)11-14-25(23)36-18(4)28(34)35-6-2/h7-18H,5-6H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | GEBDRTWXQIWDET-ZWKOTPCHSA-N |
| XLogP | 6.04 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|