C31H30BrN5O6 — CID 126332771
2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]-N-phenylacetamide (PubChem CID 126332771) has the molecular formula C31H30BrN5O6 and a molecular weight of 648.51 g/mol. Its IUPAC name is 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126332771 |
| Molecular Formula | C31H30BrN5O6 |
| Molecular Weight | 648.51 g/mol |
| Exact Mass | 647.14 |
| IUPAC Name | 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C31H30BrN5O6/c1-2-42-27-16-20(15-26(37(40)41)29(27)43-19-28(38)34-23-11-7-4-8-12-23)18-33-36-30(21-9-5-3-6-10-21)35-25-14-13-22(32)17-24(25)31(36)39/h4,7-8,11-18,21H,2-3,5-6,9-10,19H2,1H3,(H,34,38) |
| InChIKey | MNXOIBKUPQNHLK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|