About N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide
N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 1263332) has the molecular formula C13H15NO3S2
and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide.
Molecular Properties
| Compound Name | N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide |
| PubChem CID | 1263332 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2cc(C)sc2C)c1 |
| InChI | InChI=1S/C13H15NO3S2/c1-9-7-13(10(2)18-9)19(15,16)14-11-5-4-6-12(8-11)17-3/h4-8,14H,1-3H3 |
| InChIKey | IAGWNQABJNPMRD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide?
The IUPAC name of N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide (CID 1263332) is N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide.
What is the SMILES notation for N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide?
The canonical SMILES for N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide is COc1cccc(NS(=O)(=O)c2cc(C)sc2C)c1.
What is the InChIKey of N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide?
The InChIKey is IAGWNQABJNPMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3S2/c1-9-7-13(10(2)18-9)19(15,16)14-11-5-4-6-12(8-11)17-3/h4-8,14H,1-3H3.
What are the key properties of N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide?
N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide has a molecular weight of 297.40 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxyphenyl)-2,5-dimethylthiophene-3-sulfonamide is sourced from PubChem (CID 1263332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).