About titanium;bis(1,3,5-trimethylbenzene)
titanium;bis(1,3,5-trimethylbenzene) (PubChem CID 12633333) has the molecular formula C18H24Ti
and a molecular weight of 288.26 g/mol. Its IUPAC name is titanium;bis(1,3,5-trimethylbenzene).
Molecular Properties
| Compound Name | titanium;bis(1,3,5-trimethylbenzene) |
| PubChem CID | 12633333 |
| Molecular Formula | C18H24Ti |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | titanium;bis(1,3,5-trimethylbenzene) |
| SMILES | Cc1cc(C)cc(C)c1.Cc1cc(C)cc(C)c1.[Ti] |
| InChI | InChI=1S/2C9H12.Ti/c2*1-7-4-8(2)6-9(3)5-7;/h2*4-6H,1-3H3; |
| InChIKey | FZLKBKAIGGOJGQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze titanium;bis(1,3,5-trimethylbenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of titanium;bis(1,3,5-trimethylbenzene)?
The IUPAC name of titanium;bis(1,3,5-trimethylbenzene) (CID 12633333) is titanium;bis(1,3,5-trimethylbenzene).
What is the SMILES notation for titanium;bis(1,3,5-trimethylbenzene)?
The canonical SMILES for titanium;bis(1,3,5-trimethylbenzene) is Cc1cc(C)cc(C)c1.Cc1cc(C)cc(C)c1.[Ti].
What is the InChIKey of titanium;bis(1,3,5-trimethylbenzene)?
The InChIKey is FZLKBKAIGGOJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H12.Ti/c2*1-7-4-8(2)6-9(3)5-7;/h2*4-6H,1-3H3;.
What are the key properties of titanium;bis(1,3,5-trimethylbenzene)?
titanium;bis(1,3,5-trimethylbenzene) has a molecular weight of 288.26 g/mol, XLogP of 5.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for titanium;bis(1,3,5-trimethylbenzene) is sourced from PubChem (CID 12633333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).