C30H29BrCl2N2O4S2 — CID 126335311
N-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide (PubChem CID 126335311) has the molecular formula C30H29BrCl2N2O4S2 and a molecular weight of 696.52 g/mol. Its IUPAC name is N-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 126335311 |
| Molecular Formula | C30H29BrCl2N2O4S2 |
| Molecular Weight | 696.52 g/mol |
| Exact Mass | 694.01 |
| IUPAC Name | N-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(NC(=O)C34CC5CC(CC(C5)C3)C4)C2=O)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H29BrCl2N2O4S2/c1-2-38-24-9-16(8-22(31)26(24)39-15-20-3-4-21(32)11-23(20)33)10-25-27(36)35(29(40)41-25)34-28(37)30-12-17-5-18(13-30)7-19(6-17)14-30/h3-4,8-11,17-19H,2,5-7,12-15H2,1H3,(H,34,37)/b25-10- |
| InChIKey | DHQPYGJEASKVBT-MRUKODCESA-N |
| XLogP | 8.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.52 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|