C11H16O2 — CID 12633604
1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid (PubChem CID 12633604) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid.
| Compound Name | 1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 12633604 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylic acid |
| SMILES | O=C(O)C1CCC=C2CCCCC21 |
| InChI | InChI=1S/C11H16O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h5,9-10H,1-4,6-7H2,(H,12,13) |
| InChIKey | JFLZTCBJETUSKC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|