C23H24BrN3O5 — CID 126336756
(2S)-2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126336756) has the molecular formula C23H24BrN3O5 and a molecular weight of 502.37 g/mol. Its IUPAC name is (2S)-2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126336756 |
| Molecular Formula | C23H24BrN3O5 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | (2S)-2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(O[C@@H](C)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C23H24BrN3O5/c1-5-13(2)21-26-18-8-7-16(24)11-17(18)22(28)27(21)25-12-15-6-9-19(20(10-15)31-4)32-14(3)23(29)30/h6-14H,5H2,1-4H3,(H,29,30)/t13-,14+/m1/s1 |
| InChIKey | BUYDXZNZXHTCAA-KGLIPLIRSA-N |
| XLogP | 4.42 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|