About O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate
O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate (PubChem CID 126337347) has the molecular formula C30H24N6O3S
and a molecular weight of 548.63 g/mol. Its IUPAC name is O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate.
Molecular Properties
| Compound Name | O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate |
| PubChem CID | 126337347 |
| Molecular Formula | C30H24N6O3S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate |
| SMILES | O=C(Nc1ccc2nc(-c3ccccn3)c(-c3ccccn3)nc2c1)c1ccc(OC(=S)N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H24N6O3S/c37-29(20-7-10-22(11-8-20)39-30(40)36-15-17-38-18-16-36)33-21-9-12-23-26(19-21)35-28(25-6-2-4-14-32-25)27(34-23)24-5-1-3-13-31-24/h1-14,19H,15-18H2,(H,33,37) |
| InChIKey | DBDUYYIZNRFBQY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate?
The IUPAC name of O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate (CID 126337347) is O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate.
What is the SMILES notation for O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate?
The canonical SMILES for O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate is O=C(Nc1ccc2nc(-c3ccccn3)c(-c3ccccn3)nc2c1)c1ccc(OC(=S)N2CCOCC2)cc1.
What is the InChIKey of O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate?
The InChIKey is DBDUYYIZNRFBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24N6O3S/c37-29(20-7-10-22(11-8-20)39-30(40)36-15-17-38-18-16-36)33-21-9-12-23-26(19-21)35-28(25-6-2-4-14-32-25)27(34-23)24-5-1-3-13-31-24/h1-14,19H,15-18H2,(H,33,37).
What are the key properties of O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate?
O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate has a molecular weight of 548.63 g/mol, XLogP of 5.00, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for O-[4-[(2,3-dipyridin-2-ylquinoxalin-6-yl)carbamoyl]phenyl] morpholine-4-carbothioate is sourced from PubChem (CID 126337347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).