C12F21N3 — CID 12633763
3,5,6-tris(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,4-triazine (PubChem CID 12633763) has the molecular formula C12F21N3 and a molecular weight of 585.11 g/mol. Its IUPAC name is 3,5,6-tris(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,4-triazine.
| Compound Name | 3,5,6-tris(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 12633763 |
| Molecular Formula | C12F21N3 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.98 |
| IUPAC Name | 3,5,6-tris(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,4-triazine |
| SMILES | FC(F)(F)C(F)(c1nnc(C(F)(C(F)(F)F)C(F)(F)F)c(C(F)(C(F)(F)F)C(F)(F)F)n1)C(F)(F)F |
| InChI | InChI=1S/C12F21N3/c13-4(7(16,17)18,8(19,20)21)1-2(5(14,9(22,23)24)10(25,26)27)35-36-3(34-1)6(15,11(28,29)30)12(31,32)33 |
| InChIKey | FSPJHYZEVIYQMY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |