C23H20Cl2N2O4S — CID 126338888
methyl (3R,4S)-6-benzylsulfanyl-5-cyano-4-(3,5-dichloro-4-ethoxyphenyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 126338888) has the molecular formula C23H20Cl2N2O4S and a molecular weight of 491.40 g/mol. Its IUPAC name is methyl (3R,4S)-6-benzylsulfanyl-5-cyano-4-(3,5-dichloro-4-ethoxyphenyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl (3R,4S)-6-benzylsulfanyl-5-cyano-4-(3,5-dichloro-4-ethoxyphenyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126338888 |
| Molecular Formula | C23H20Cl2N2O4S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | methyl (3R,4S)-6-benzylsulfanyl-5-cyano-4-(3,5-dichloro-4-ethoxyphenyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | CCOc1c(Cl)cc([C@H]2C(C#N)=C(SCc3ccccc3)NC(=O)[C@@H]2C(=O)OC)cc1Cl |
| InChI | InChI=1S/C23H20Cl2N2O4S/c1-3-31-20-16(24)9-14(10-17(20)25)18-15(11-26)22(27-21(28)19(18)23(29)30-2)32-12-13-7-5-4-6-8-13/h4-10,18-19H,3,12H2,1-2H3,(H,27,28)/t18-,19+/m0/s1 |
| InChIKey | HZAIEVWQUZGTLB-RBUKOAKNSA-N |
| XLogP | 5.06 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|