C27H22BrN3O3S2 — CID 126340403
4-[[2-bromo-4-[(E)-[3-[4-(dimethylamino)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126340403) has the molecular formula C27H22BrN3O3S2 and a molecular weight of 580.53 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(E)-[3-[4-(dimethylamino)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 4-[[2-bromo-4-[(E)-[3-[4-(dimethylamino)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126340403 |
| Molecular Formula | C27H22BrN3O3S2 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | 4-[[2-bromo-4-[(E)-[3-[4-(dimethylamino)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3ccc(N(C)C)cc3)C2=O)cc(Br)c1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H22BrN3O3S2/c1-30(2)20-8-10-21(11-9-20)31-26(32)24(36-27(31)35)14-19-12-22(28)25(23(13-19)33-3)34-16-18-6-4-17(15-29)5-7-18/h4-14H,16H2,1-3H3/b24-14+ |
| InChIKey | VMALSNDZUQTZLK-ZVHZXABRSA-N |
| XLogP | 6.38 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|