C20H22BrN3O4S — CID 126341073
methyl (3R,4S)-4-(3-bromophenyl)-6-[2-(butylamino)-2-oxoethyl]sulfanyl-5-cyano-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 126341073) has the molecular formula C20H22BrN3O4S and a molecular weight of 480.38 g/mol. Its IUPAC name is methyl (3R,4S)-4-(3-bromophenyl)-6-[2-(butylamino)-2-oxoethyl]sulfanyl-5-cyano-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl (3R,4S)-4-(3-bromophenyl)-6-[2-(butylamino)-2-oxoethyl]sulfanyl-5-cyano-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126341073 |
| Molecular Formula | C20H22BrN3O4S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | methyl (3R,4S)-4-(3-bromophenyl)-6-[2-(butylamino)-2-oxoethyl]sulfanyl-5-cyano-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | CCCCNC(=O)CSC1=C(C#N)[C@H](c2cccc(Br)c2)[C@@H](C(=O)OC)C(=O)N1 |
| InChI | InChI=1S/C20H22BrN3O4S/c1-3-4-8-23-15(25)11-29-19-14(10-22)16(12-6-5-7-13(21)9-12)17(18(26)24-19)20(27)28-2/h5-7,9,16-17H,3-4,8,11H2,1-2H3,(H,23,25)(H,24,26)/t16-,17+/m0/s1 |
| InChIKey | NOMGLDSHHJOTCE-DLBZAZTESA-N |
| XLogP | 2.84 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|