C26H23Br2ClN2O4 — CID 126341596
N-[(E)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide (PubChem CID 126341596) has the molecular formula C26H23Br2ClN2O4 and a molecular weight of 622.74 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126341596 |
| Molecular Formula | C26H23Br2ClN2O4 |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 619.97 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OCc3ccccc3Cl)c(Br)c2)cc1OCC |
| InChI | InChI=1S/C26H23Br2ClN2O4/c1-3-11-34-23-10-9-18(14-24(23)33-4-2)26(32)31-30-15-17-12-20(27)25(21(28)13-17)35-16-19-7-5-6-8-22(19)29/h3,5-10,12-15H,1,4,11,16H2,2H3,(H,31,32)/b30-15+ |
| InChIKey | OBQGVIXFSPWZNX-FJEPWZHXSA-N |
| XLogP | 7.17 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|