C25H28N2Se — CID 12634307
13-(2-methylbut-3-en-2-yl)-1,11-diazapentacyclo[12.8.0.02,11.03,8.015,20]docosa-3,5,7,15,17,19-hexaene-12-selone (PubChem CID 12634307) has the molecular formula C25H28N2Se and a molecular weight of 435.47 g/mol. Its IUPAC name is 13-(2-methylbut-3-en-2-yl)-1,11-diazapentacyclo[12.8.0.02,11.03,8.015,20]docosa-3,5,7,15,17,19-hexaene-12-selone.
| Compound Name | 13-(2-methylbut-3-en-2-yl)-1,11-diazapentacyclo[12.8.0.02,11.03,8.015,20]docosa-3,5,7,15,17,19-hexaene-12-selone |
|---|---|
| PubChem CID | 12634307 |
| Molecular Formula | C25H28N2Se |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 13-(2-methylbut-3-en-2-yl)-1,11-diazapentacyclo[12.8.0.02,11.03,8.015,20]docosa-3,5,7,15,17,19-hexaene-12-selone |
| SMILES | C=CC(C)(C)C1C(=[Se])N2CCc3ccccc3C2N2CCc3ccccc3C12 |
| InChI | InChI=1S/C25H28N2Se/c1-4-25(2,3)21-22-19-11-7-5-9-17(19)13-15-26(22)23-20-12-8-6-10-18(20)14-16-27(23)24(21)28/h4-12,21-23H,1,13-16H2,2-3H3 |
| InChIKey | CZYOJZHFLOVCMH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|