C21H19BrN2O4 — CID 126343528
(1S,2R,10S,11R,12S)-10-(6-bromo-1,3-benzodioxol-5-yl)-5-nitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene (PubChem CID 126343528) has the molecular formula C21H19BrN2O4 and a molecular weight of 443.30 g/mol. Its IUPAC name is (1S,2R,10S,11R,12S)-10-(6-bromo-1,3-benzodioxol-5-yl)-5-nitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene.
| Compound Name | (1S,2R,10S,11R,12S)-10-(6-bromo-1,3-benzodioxol-5-yl)-5-nitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene |
|---|---|
| PubChem CID | 126343528 |
| Molecular Formula | C21H19BrN2O4 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | (1S,2R,10S,11R,12S)-10-(6-bromo-1,3-benzodioxol-5-yl)-5-nitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1[C@@H](c1cc3c(cc1Br)OCO3)N2 |
| InChI | InChI=1S/C21H19BrN2O4/c22-15-8-18-17(27-9-28-18)7-13(15)21-20-11-2-1-10(5-11)19(20)14-6-12(24(25)26)3-4-16(14)23-21/h3-4,6-8,10-11,19-21,23H,1-2,5,9H2/t10-,11-,19-,20+,21+/m0/s1 |
| InChIKey | UJRLGRNFSALBKI-NMCONKOPSA-N |
| XLogP | 5.38 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|