C19H23N3O3 — CID 1263453
4-methoxy-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]quinoline-2-carboxamide (PubChem CID 1263453) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-methoxy-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]quinoline-2-carboxamide.
| Compound Name | 4-methoxy-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 1263453 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 4-methoxy-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]quinoline-2-carboxamide |
| SMILES | COc1cc(C(=O)N[C@@H](C)C(=O)N2CCCCC2)nc2ccccc12 |
| InChI | InChI=1S/C19H23N3O3/c1-13(19(24)22-10-6-3-7-11-22)20-18(23)16-12-17(25-2)14-8-4-5-9-15(14)21-16/h4-5,8-9,12-13H,3,6-7,10-11H2,1-2H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | ROWWHYKGPRIERW-ZDUSSCGKSA-N |
| XLogP | 2.37 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |