ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate

C11H16O3 — CID 12634562

IUPACethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate
SMILESCCOC(=O)C1(C)CCC(C)=CC1=O
InChIInChI=1S/C11H16O3/c1-4-14-10(13)11(3)6-5-8(2)7-9(11)12/h7H,4-6H2,1-3H3
InChIKeyZCFNYOZOCJKWGG-UHFFFAOYSA-N
MW196.25 g/mol
LogP1.87
Rot. Bonds2

About ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate

ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 12634562) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate.

Molecular Properties

Compound Nameethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate
PubChem CID12634562
Molecular FormulaC11H16O3
Molecular Weight196.25 g/mol
Exact Mass196.11
IUPAC Nameethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate
SMILESCCOC(=O)C1(C)CCC(C)=CC1=O
InChIInChI=1S/C11H16O3/c1-4-14-10(13)11(3)6-5-8(2)7-9(11)12/h7H,4-6H2,1-3H3
InChIKeyZCFNYOZOCJKWGG-UHFFFAOYSA-N
XLogP1.87
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.25
LogP ≤ 51.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate?
The IUPAC name of ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate (CID 12634562) is ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate.
What is the SMILES notation for ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate?
The canonical SMILES for ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate is CCOC(=O)C1(C)CCC(C)=CC1=O.
What is the InChIKey of ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate?
The InChIKey is ZCFNYOZOCJKWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-4-14-10(13)11(3)6-5-8(2)7-9(11)12/h7H,4-6H2,1-3H3.
What are the key properties of ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate?
ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,4-dimethyl-2-oxocyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 12634562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).