C22H20N2O4S — CID 126346371
N-(3-acetylphenyl)-2-[benzenesulfonyl(methyl)amino]benzamide (PubChem CID 126346371) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[benzenesulfonyl(methyl)amino]benzamide.
| Compound Name | N-(3-acetylphenyl)-2-[benzenesulfonyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 126346371 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-(3-acetylphenyl)-2-[benzenesulfonyl(methyl)amino]benzamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccccc2N(C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H20N2O4S/c1-16(25)17-9-8-10-18(15-17)23-22(26)20-13-6-7-14-21(20)24(2)29(27,28)19-11-4-3-5-12-19/h3-15H,1-2H3,(H,23,26) |
| InChIKey | SREBSXFVBNVYBC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |