C6H8O3 — CID 12634722
methyl 2,5-dihydrofuran-2-carboxylate (PubChem CID 12634722) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is methyl 2,5-dihydrofuran-2-carboxylate.
| Compound Name | methyl 2,5-dihydrofuran-2-carboxylate |
|---|---|
| PubChem CID | 12634722 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | methyl 2,5-dihydrofuran-2-carboxylate |
| SMILES | COC(=O)C1C=CCO1 |
| InChI | InChI=1S/C6H8O3/c1-8-6(7)5-3-2-4-9-5/h2-3,5H,4H2,1H3 |
| InChIKey | JEXXYHJLISOZHN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|