About N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide
N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide (PubChem CID 12635005) has the molecular formula C14H19NOSe
and a molecular weight of 296.27 g/mol. Its IUPAC name is N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide |
| PubChem CID | 12635005 |
| Molecular Formula | C14H19NOSe |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide |
| SMILES | CC(=O)N[C@H]1CCCC[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C14H19NOSe/c1-11(16)15-13-9-5-6-10-14(13)17-12-7-3-2-4-8-12/h2-4,7-8,13-14H,5-6,9-10H2,1H3,(H,15,16)/t13-,14-/m0/s1 |
| InChIKey | OVKIQHMFUDOLTJ-KBPBESRZSA-N |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide?
The IUPAC name of N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide (CID 12635005) is N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide.
What is the SMILES notation for N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide?
The canonical SMILES for N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide is CC(=O)N[C@H]1CCCC[C@@H]1[Se]c1ccccc1.
What is the InChIKey of N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide?
The InChIKey is OVKIQHMFUDOLTJ-KBPBESRZSA-N. The full InChI is InChI=1S/C14H19NOSe/c1-11(16)15-13-9-5-6-10-14(13)17-12-7-3-2-4-8-12/h2-4,7-8,13-14H,5-6,9-10H2,1H3,(H,15,16)/t13-,14-/m0/s1.
What are the key properties of N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide?
N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide has a molecular weight of 296.27 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2S)-2-phenylselanylcyclohexyl]acetamide is sourced from PubChem (CID 12635005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).