C19H13Cl2N5O4S — CID 126351893
2-[[5-(5-chloro-1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 126351893) has the molecular formula C19H13Cl2N5O4S and a molecular weight of 478.32 g/mol. Its IUPAC name is 2-[[5-(5-chloro-1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(5-chloro-1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126351893 |
| Molecular Formula | C19H13Cl2N5O4S |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | 2-[[5-(5-chloro-1-benzofuran-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | Cn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)nnc1-c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C19H13Cl2N5O4S/c1-25-18(16-7-10-6-11(20)2-5-15(10)30-16)23-24-19(25)31-9-17(27)22-14-8-12(26(28)29)3-4-13(14)21/h2-8H,9H2,1H3,(H,22,27) |
| InChIKey | LYSGLBOOJYXQPS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|