About 8-acetyloxyocta-2,6-diynyl acetate
8-acetyloxyocta-2,6-diynyl acetate (PubChem CID 12635233) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 8-acetyloxyocta-2,6-diynyl acetate.
Molecular Properties
| Compound Name | 8-acetyloxyocta-2,6-diynyl acetate |
| PubChem CID | 12635233 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 8-acetyloxyocta-2,6-diynyl acetate |
| SMILES | CC(=O)OCC#CCCC#CCOC(C)=O |
| InChI | InChI=1S/C12H14O4/c1-11(13)15-9-7-5-3-4-6-8-10-16-12(2)14/h3-4,9-10H2,1-2H3 |
| InChIKey | ZGDBLULGKNJWNT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-acetyloxyocta-2,6-diynyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-acetyloxyocta-2,6-diynyl acetate?
The IUPAC name of 8-acetyloxyocta-2,6-diynyl acetate (CID 12635233) is 8-acetyloxyocta-2,6-diynyl acetate.
What is the SMILES notation for 8-acetyloxyocta-2,6-diynyl acetate?
The canonical SMILES for 8-acetyloxyocta-2,6-diynyl acetate is CC(=O)OCC#CCCC#CCOC(C)=O.
What is the InChIKey of 8-acetyloxyocta-2,6-diynyl acetate?
The InChIKey is ZGDBLULGKNJWNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-11(13)15-9-7-5-3-4-6-8-10-16-12(2)14/h3-4,9-10H2,1-2H3.
What are the key properties of 8-acetyloxyocta-2,6-diynyl acetate?
8-acetyloxyocta-2,6-diynyl acetate has a molecular weight of 222.24 g/mol, XLogP of 0.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-acetyloxyocta-2,6-diynyl acetate is sourced from PubChem (CID 12635233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).