C12H12BrN3OS2 — CID 126353179
3-[(Z)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126353179) has the molecular formula C12H12BrN3OS2 and a molecular weight of 358.29 g/mol. Its IUPAC name is 3-[(Z)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(Z)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126353179 |
| Molecular Formula | C12H12BrN3OS2 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 3-[(Z)-[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(/C=N\N2C(=O)CSC2=S)cc1Br |
| InChI | InChI=1S/C12H12BrN3OS2/c1-15(2)10-4-3-8(5-9(10)13)6-14-16-11(17)7-19-12(16)18/h3-6H,7H2,1-2H3/b14-6- |
| InChIKey | PJTDIHNLNGYTSH-NSIKDUERSA-N |
| XLogP | 2.71 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|