About (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine
(E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine (PubChem CID 12635406) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine.
Molecular Properties
| Compound Name | (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine |
| PubChem CID | 12635406 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine |
| SMILES | CC(C)(C)/C=N/N=C/C(C)(C)C |
| InChI | InChI=1S/C10H20N2/c1-9(2,3)7-11-12-8-10(4,5)6/h7-8H,1-6H3/b11-7+,12-8+ |
| InChIKey | FQKCIYLEQYBWAA-MKICQXMISA-N |
| XLogP | 3.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine?
The IUPAC name of (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine (CID 12635406) is (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine.
What is the SMILES notation for (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine?
The canonical SMILES for (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine is CC(C)(C)/C=N/N=C/C(C)(C)C.
What is the InChIKey of (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine?
The InChIKey is FQKCIYLEQYBWAA-MKICQXMISA-N. The full InChI is InChI=1S/C10H20N2/c1-9(2,3)7-11-12-8-10(4,5)6/h7-8H,1-6H3/b11-7+,12-8+.
What are the key properties of (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine?
(E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine has a molecular weight of 168.28 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropan-1-imine is sourced from PubChem (CID 12635406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).