C21H18Cl5N5O2S — CID 126354673
2,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126354673) has the molecular formula C21H18Cl5N5O2S and a molecular weight of 581.74 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126354673 |
| Molecular Formula | C21H18Cl5N5O2S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 578.96 |
| IUPAC Name | 2,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1[C@H](C)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl5N5O2S/c1-3-31-19(10(2)27-20(33)12-5-4-11(22)6-13(12)23)29-30-21(31)34-9-18(32)28-17-8-15(25)14(24)7-16(17)26/h4-8,10H,3,9H2,1-2H3,(H,27,33)(H,28,32)/t10-/m0/s1 |
| InChIKey | QOOPSNBAHIBQLF-JTQLQIEISA-N |
| XLogP | 6.79 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|