C27H23Cl2NO3S2 — CID 126355189
(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126355189) has the molecular formula C27H23Cl2NO3S2 and a molecular weight of 544.53 g/mol. Its IUPAC name is (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126355189 |
| Molecular Formula | C27H23Cl2NO3S2 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-(3,4-dimethylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(c3ccc(C)c(C)c3)C2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H23Cl2NO3S2/c1-4-32-24-13-18(7-10-23(24)33-15-19-6-9-21(28)22(29)12-19)14-25-26(31)30(27(34)35-25)20-8-5-16(2)17(3)11-20/h5-14H,4,15H2,1-3H3/b25-14+ |
| InChIKey | POEGTPCWXGJOJX-AFUMVMLFSA-N |
| XLogP | 7.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|