About 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea
1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea (PubChem CID 12635590) has the molecular formula C9H11Br2N3S
and a molecular weight of 353.08 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea.
Molecular Properties
| Compound Name | 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea |
| PubChem CID | 12635590 |
| Molecular Formula | C9H11Br2N3S |
| Molecular Weight | 353.08 g/mol |
| Exact Mass | 350.90 |
| IUPAC Name | 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea |
| SMILES | NCCNC(=S)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C9H11Br2N3S/c10-6-2-1-3-7(11)8(6)14-9(15)13-5-4-12/h1-3H,4-5,12H2,(H2,13,14,15) |
| InChIKey | WXEUOYNJQUDBSF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea?
The IUPAC name of 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea (CID 12635590) is 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea.
What is the SMILES notation for 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea?
The canonical SMILES for 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea is NCCNC(=S)Nc1c(Br)cccc1Br.
What is the InChIKey of 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea?
The InChIKey is WXEUOYNJQUDBSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Br2N3S/c10-6-2-1-3-7(11)8(6)14-9(15)13-5-4-12/h1-3H,4-5,12H2,(H2,13,14,15).
What are the key properties of 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea?
1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea has a molecular weight of 353.08 g/mol, XLogP of 2.46, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethyl)-3-(2,6-dibromophenyl)thiourea is sourced from PubChem (CID 12635590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).