C20H25F3N2O3 — CID 126355980
[(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-hydroxyphenyl)methanone (PubChem CID 126355980) has the molecular formula C20H25F3N2O3 and a molecular weight of 398.43 g/mol. Its IUPAC name is [(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 126355980 |
| Molecular Formula | C20H25F3N2O3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-hydroxyphenyl)methanone |
| SMILES | CCC(C)(C)[C@@H]1CCC2=NN(C(=O)c3ccc(O)cc3)[C@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C20H25F3N2O3/c1-4-18(2,3)13-7-10-16-15(11-13)19(28,20(21,22)23)25(24-16)17(27)12-5-8-14(26)9-6-12/h5-6,8-9,13,15,26,28H,4,7,10-11H2,1-3H3/t13-,15+,19-/m1/s1 |
| InChIKey | RHJVAHTXHJXJQI-FRIZHTMISA-N |
| XLogP | 4.31 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |