C24H17I2NO2S2 — CID 126356044
(5Z)-5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126356044) has the molecular formula C24H17I2NO2S2 and a molecular weight of 669.35 g/mol. Its IUPAC name is (5Z)-5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126356044 |
| Molecular Formula | C24H17I2NO2S2 |
| Molecular Weight | 669.35 g/mol |
| Exact Mass | 668.88 |
| IUPAC Name | (5Z)-5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3cc(I)c(OCc4ccccc4)c(I)c3)SC2=S)cc1 |
| InChI | InChI=1S/C24H17I2NO2S2/c1-15-7-9-18(10-8-15)27-23(28)21(31-24(27)30)13-17-11-19(25)22(20(26)12-17)29-14-16-5-3-2-4-6-16/h2-13H,14H2,1H3/b21-13- |
| InChIKey | RIXXTFYQGZFDFA-BKUYFWCQSA-N |
| XLogP | 7.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.35 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|