About methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate
methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate (PubChem CID 12635613) has the molecular formula C10H13Cl2N3S
and a molecular weight of 278.21 g/mol. Its IUPAC name is methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate |
| PubChem CID | 12635613 |
| Molecular Formula | C10H13Cl2N3S |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate |
| SMILES | CS/C(=N\CCN)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H13Cl2N3S/c1-16-10(14-6-5-13)15-9-7(11)3-2-4-8(9)12/h2-4H,5-6,13H2,1H3,(H,14,15) |
| InChIKey | SADGKBJCUMRAFE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate?
The IUPAC name of methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate (CID 12635613) is methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate.
What is the SMILES notation for methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate?
The canonical SMILES for methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate is CS/C(=N\CCN)Nc1c(Cl)cccc1Cl.
What is the InChIKey of methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate?
The InChIKey is SADGKBJCUMRAFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl2N3S/c1-16-10(14-6-5-13)15-9-7(11)3-2-4-8(9)12/h2-4H,5-6,13H2,1H3,(H,14,15).
What are the key properties of methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate?
methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate has a molecular weight of 278.21 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-(2-aminoethyl)-N-(2,6-dichlorophenyl)carbamimidothioate is sourced from PubChem (CID 12635613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).