C14H11I2N3O5 — CID 126356976
2-[(Z)-2-(2-ethoxy-3,5-diiodophenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 126356976) has the molecular formula C14H11I2N3O5 and a molecular weight of 555.07 g/mol. Its IUPAC name is 2-[(Z)-2-(2-ethoxy-3,5-diiodophenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[(Z)-2-(2-ethoxy-3,5-diiodophenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 126356976 |
| Molecular Formula | C14H11I2N3O5 |
| Molecular Weight | 555.07 g/mol |
| Exact Mass | 554.88 |
| IUPAC Name | 2-[(Z)-2-(2-ethoxy-3,5-diiodophenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | CCOc1c(I)cc(I)cc1/C=C\c1nc(O)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C14H11I2N3O5/c1-2-24-12-7(5-8(15)6-9(12)16)3-4-10-17-13(20)11(19(22)23)14(21)18-10/h3-6H,2H2,1H3,(H2,17,18,20,21)/b4-3- |
| InChIKey | ZXNSFBOACREGPL-ARJAWSKDSA-N |
| XLogP | 3.16 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.07 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|