C33H25NO3S2 — CID 126357269
(5Z)-5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-naphthalen-1-yl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126357269) has the molecular formula C33H25NO3S2 and a molecular weight of 547.70 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-naphthalen-1-yl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-naphthalen-1-yl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126357269 |
| Molecular Formula | C33H25NO3S2 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-naphthalen-1-yl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(c3cccc4ccccc34)C2=O)ccc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H25NO3S2/c1-2-36-30-19-22(15-17-29(30)37-21-23-14-16-24-8-3-4-10-26(24)18-23)20-31-32(35)34(33(38)39-31)28-13-7-11-25-9-5-6-12-27(25)28/h3-20H,2,21H2,1H3/b31-20- |
| InChIKey | VCSFNOXMNBETJD-GTWSWNCMSA-N |
| XLogP | 8.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|