C24H26Cl2N6O4S — CID 126357427
2,4-dichloro-N-[(1R)-1-[4-ethyl-5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide (PubChem CID 126357427) has the molecular formula C24H26Cl2N6O4S and a molecular weight of 565.48 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1R)-1-[4-ethyl-5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1R)-1-[4-ethyl-5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 126357427 |
| Molecular Formula | C24H26Cl2N6O4S |
| Molecular Weight | 565.48 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 2,4-dichloro-N-[(1R)-1-[4-ethyl-5-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)nnc1[C@@H](CC(C)C)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H26Cl2N6O4S/c1-4-31-22(20(11-14(2)3)28-23(34)18-10-5-15(25)12-19(18)26)29-30-24(31)37-13-21(33)27-16-6-8-17(9-7-16)32(35)36/h5-10,12,14,20H,4,11,13H2,1-3H3,(H,27,33)(H,28,34)/t20-/m1/s1 |
| InChIKey | YOVHNQGCTIPHON-HXUWFJFHSA-N |
| XLogP | 5.76 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|