C10H20OSi — CID 12635913
cis-(2R,3R)-2-methyl-3-trimethylsilylcyclohexan-1-one (PubChem CID 12635913) has the molecular formula C10H20OSi and a molecular weight of 184.35 g/mol. Its IUPAC name is cis-(2R,3R)-2-methyl-3-trimethylsilylcyclohexan-1-one.
| Compound Name | cis-(2R,3R)-2-methyl-3-trimethylsilylcyclohexan-1-one |
|---|---|
| PubChem CID | 12635913 |
| Molecular Formula | C10H20OSi |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | cis-(2R,3R)-2-methyl-3-trimethylsilylcyclohexan-1-one |
| SMILES | C[C@@H]1C(=O)CCC[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C10H20OSi/c1-8-9(11)6-5-7-10(8)12(2,3)4/h8,10H,5-7H2,1-4H3/t8-,10-/m1/s1 |
| InChIKey | VHMHPHNLPFHUAQ-PSASIEDQSA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|