C26H31Cl2N5O2S — CID 126359474
3,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide (PubChem CID 126359474) has the molecular formula C26H31Cl2N5O2S and a molecular weight of 548.54 g/mol. Its IUPAC name is 3,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 126359474 |
| Molecular Formula | C26H31Cl2N5O2S |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 3,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
| SMILES | CCn1c(SCC(=O)Nc2c(C)cc(C)cc2C)nnc1[C@@H](NC(=O)c1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C26H31Cl2N5O2S/c1-7-33-24(22(14(2)3)30-25(35)18-8-9-19(27)20(28)12-18)31-32-26(33)36-13-21(34)29-23-16(5)10-15(4)11-17(23)6/h8-12,14,22H,7,13H2,1-6H3,(H,29,34)(H,30,35)/t22-/m0/s1 |
| InChIKey | VCTKCEKYTXYIHG-QFIPXVFZSA-N |
| XLogP | 6.39 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |