C26H20ClNO5S — CID 126359942
(5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[[3-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126359942) has the molecular formula C26H20ClNO5S and a molecular weight of 493.97 g/mol. Its IUPAC name is (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[[3-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[[3-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126359942 |
| Molecular Formula | C26H20ClNO5S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[[3-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cccc(OCCOc3ccccc3)c2)C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20ClNO5S/c27-20-11-9-19(10-12-20)23(29)17-28-25(30)24(34-26(28)31)16-18-5-4-8-22(15-18)33-14-13-32-21-6-2-1-3-7-21/h1-12,15-16H,13-14,17H2/b24-16+ |
| InChIKey | FUOXSMKESAVBKM-LFVJCYFKSA-N |
| XLogP | 5.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|