About methyl 3-(methylamino)butanoate
methyl 3-(methylamino)butanoate (PubChem CID 12636115) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is methyl 3-(methylamino)butanoate.
Molecular Properties
| Compound Name | methyl 3-(methylamino)butanoate |
| PubChem CID | 12636115 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | methyl 3-(methylamino)butanoate |
| SMILES | CNC(C)CC(=O)OC |
| InChI | InChI=1S/C6H13NO2/c1-5(7-2)4-6(8)9-3/h5,7H,4H2,1-3H3 |
| InChIKey | HMEOAJAQJYMXBL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-(methylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(methylamino)butanoate?
The IUPAC name of methyl 3-(methylamino)butanoate (CID 12636115) is methyl 3-(methylamino)butanoate.
What is the SMILES notation for methyl 3-(methylamino)butanoate?
The canonical SMILES for methyl 3-(methylamino)butanoate is CNC(C)CC(=O)OC.
What is the InChIKey of methyl 3-(methylamino)butanoate?
The InChIKey is HMEOAJAQJYMXBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-5(7-2)4-6(8)9-3/h5,7H,4H2,1-3H3.
What are the key properties of methyl 3-(methylamino)butanoate?
methyl 3-(methylamino)butanoate has a molecular weight of 131.18 g/mol, XLogP of 0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(methylamino)butanoate is sourced from PubChem (CID 12636115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).