About (1R)-1-cyclohexyl-2,2,2-trifluoroethanol
(1R)-1-cyclohexyl-2,2,2-trifluoroethanol (PubChem CID 12636128) has the molecular formula C8H13F3O
and a molecular weight of 182.18 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | (1R)-1-cyclohexyl-2,2,2-trifluoroethanol |
| PubChem CID | 12636128 |
| Molecular Formula | C8H13F3O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1R)-1-cyclohexyl-2,2,2-trifluoroethanol |
| SMILES | O[C@H](C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H13F3O/c9-8(10,11)7(12)6-4-2-1-3-5-6/h6-7,12H,1-5H2/t7-/m1/s1 |
| InChIKey | WDWKMZMIJJTUES-SSDOTTSWSA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-cyclohexyl-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-cyclohexyl-2,2,2-trifluoroethanol?
The IUPAC name of (1R)-1-cyclohexyl-2,2,2-trifluoroethanol (CID 12636128) is (1R)-1-cyclohexyl-2,2,2-trifluoroethanol.
What is the SMILES notation for (1R)-1-cyclohexyl-2,2,2-trifluoroethanol?
The canonical SMILES for (1R)-1-cyclohexyl-2,2,2-trifluoroethanol is O[C@H](C1CCCCC1)C(F)(F)F.
What is the InChIKey of (1R)-1-cyclohexyl-2,2,2-trifluoroethanol?
The InChIKey is WDWKMZMIJJTUES-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13F3O/c9-8(10,11)7(12)6-4-2-1-3-5-6/h6-7,12H,1-5H2/t7-/m1/s1.
What are the key properties of (1R)-1-cyclohexyl-2,2,2-trifluoroethanol?
(1R)-1-cyclohexyl-2,2,2-trifluoroethanol has a molecular weight of 182.18 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-cyclohexyl-2,2,2-trifluoroethanol is sourced from PubChem (CID 12636128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).