C16H15N3O7S — CID 1263616
2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-(3-nitrophenyl)acetamide (PubChem CID 1263616) has the molecular formula C16H15N3O7S and a molecular weight of 393.38 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1263616 |
| Molecular Formula | C16H15N3O7S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-(3-nitrophenyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1cccc([N+](=O)[O-])c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15N3O7S/c1-27(23,24)18(12-5-6-14-15(8-12)26-10-25-14)9-16(20)17-11-3-2-4-13(7-11)19(21)22/h2-8H,9-10H2,1H3,(H,17,20) |
| InChIKey | SJVBLOURNRBBEE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|