C24H24N2O5S — CID 126361724
(5E)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126361724) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126361724 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (5E)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[(2-ethoxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1c(/C=C2/SC(=O)N(CC(=O)N3CCc4ccccc4C3)C2=O)cccc1OC |
| InChI | InChI=1S/C24H24N2O5S/c1-3-31-22-17(9-6-10-19(22)30-2)13-20-23(28)26(24(29)32-20)15-21(27)25-12-11-16-7-4-5-8-18(16)14-25/h4-10,13H,3,11-12,14-15H2,1-2H3/b20-13+ |
| InChIKey | GJBHTUINRTWXAJ-DEDYPNTBSA-N |
| XLogP | 3.72 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|