C23H22Cl5N5O2S — CID 126362729
2,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,6-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide (PubChem CID 126362729) has the molecular formula C23H22Cl5N5O2S and a molecular weight of 609.79 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,6-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,6-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 126362729 |
| Molecular Formula | C23H22Cl5N5O2S |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 606.99 |
| IUPAC Name | 2,4-dichloro-N-[(1S)-1-[4-ethyl-5-[2-oxo-2-(2,4,6-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
| SMILES | CCn1c(SCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)nnc1[C@@H](NC(=O)c1ccc(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C23H22Cl5N5O2S/c1-4-33-21(19(11(2)3)30-22(35)14-6-5-12(24)7-15(14)26)31-32-23(33)36-10-18(34)29-20-16(27)8-13(25)9-17(20)28/h5-9,11,19H,4,10H2,1-3H3,(H,29,34)(H,30,35)/t19-/m0/s1 |
| InChIKey | IQGLCOLNXUETJW-IBGZPJMESA-N |
| XLogP | 7.42 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |