C8H12N2O2S — CID 12636592
1,3,5,5-tetramethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 12636592) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 1,3,5,5-tetramethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3,5,5-tetramethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 12636592 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1,3,5,5-tetramethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(C)(C)C(=O)N(C)C1=S |
| InChI | InChI=1S/C8H12N2O2S/c1-8(2)5(11)9(3)7(13)10(4)6(8)12/h1-4H3 |
| InChIKey | POJOWKMTJWOUGR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|