C21H20ClN5O3S2 — CID 126367485
2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 126367485) has the molecular formula C21H20ClN5O3S2 and a molecular weight of 490.01 g/mol. Its IUPAC name is 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126367485 |
| Molecular Formula | C21H20ClN5O3S2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | C=CCn1c(CSCc2ccccc2)nnc1SCC(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H20ClN5O3S2/c1-2-10-26-19(13-31-12-15-6-4-3-5-7-15)24-25-21(26)32-14-20(28)23-18-11-16(27(29)30)8-9-17(18)22/h2-9,11H,1,10,12-14H2,(H,23,28) |
| InChIKey | RSNMXDDHNGYCAX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|