About (3R,5S)-3,5-dimethyladamantan-1-amine
(3R,5S)-3,5-dimethyladamantan-1-amine (PubChem CID 1263681) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyladamantan-1-amine.
Molecular Properties
| Compound Name | (3R,5S)-3,5-dimethyladamantan-1-amine |
| PubChem CID | 1263681 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3R,5S)-3,5-dimethyladamantan-1-amine |
| SMILES | C[C@]12CC3CC(N)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C12H21N/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8,13H2,1-2H3/t9?,10-,11+,12? |
| InChIKey | BUGYDGFZZOZRHP-WSVSKBAQSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,5S)-3,5-dimethyladamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-3,5-dimethyladamantan-1-amine?
The IUPAC name of (3R,5S)-3,5-dimethyladamantan-1-amine (CID 1263681) is (3R,5S)-3,5-dimethyladamantan-1-amine.
What is the SMILES notation for (3R,5S)-3,5-dimethyladamantan-1-amine?
The canonical SMILES for (3R,5S)-3,5-dimethyladamantan-1-amine is C[C@]12CC3CC(N)(C1)C[C@@](C)(C3)C2.
What is the InChIKey of (3R,5S)-3,5-dimethyladamantan-1-amine?
The InChIKey is BUGYDGFZZOZRHP-WSVSKBAQSA-N. The full InChI is InChI=1S/C12H21N/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8,13H2,1-2H3/t9?,10-,11+,12?.
What are the key properties of (3R,5S)-3,5-dimethyladamantan-1-amine?
(3R,5S)-3,5-dimethyladamantan-1-amine has a molecular weight of 179.31 g/mol, XLogP of 2.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3,5-dimethyladamantan-1-amine is sourced from PubChem (CID 1263681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).