C20H17Cl3N6O4S — CID 126368186
2,4-dichloro-N-[[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 126368186) has the molecular formula C20H17Cl3N6O4S and a molecular weight of 543.82 g/mol. Its IUPAC name is 2,4-dichloro-N-[[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126368186 |
| Molecular Formula | C20H17Cl3N6O4S |
| Molecular Weight | 543.82 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | 2,4-dichloro-N-[[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCn1c(CNC(=O)c2ccc(Cl)cc2Cl)nnc1SCC(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C20H17Cl3N6O4S/c1-2-28-17(9-24-19(31)13-5-3-11(21)7-15(13)23)26-27-20(28)34-10-18(30)25-16-8-12(29(32)33)4-6-14(16)22/h3-8H,2,9-10H2,1H3,(H,24,31)(H,25,30) |
| InChIKey | WFMRMJAUZZPMHN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.82 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|