About (3-aminophenyl) 4-methylbenzenesulfonate
(3-aminophenyl) 4-methylbenzenesulfonate (PubChem CID 12636920) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is (3-aminophenyl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (3-aminophenyl) 4-methylbenzenesulfonate |
| PubChem CID | 12636920 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (3-aminophenyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(N)c2)cc1 |
| InChI | InChI=1S/C13H13NO3S/c1-10-5-7-13(8-6-10)18(15,16)17-12-4-2-3-11(14)9-12/h2-9H,14H2,1H3 |
| InChIKey | RUZVAAMFWWVKGG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-aminophenyl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminophenyl) 4-methylbenzenesulfonate?
The IUPAC name of (3-aminophenyl) 4-methylbenzenesulfonate (CID 12636920) is (3-aminophenyl) 4-methylbenzenesulfonate.
What is the SMILES notation for (3-aminophenyl) 4-methylbenzenesulfonate?
The canonical SMILES for (3-aminophenyl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)Oc2cccc(N)c2)cc1.
What is the InChIKey of (3-aminophenyl) 4-methylbenzenesulfonate?
The InChIKey is RUZVAAMFWWVKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-10-5-7-13(8-6-10)18(15,16)17-12-4-2-3-11(14)9-12/h2-9H,14H2,1H3.
What are the key properties of (3-aminophenyl) 4-methylbenzenesulfonate?
(3-aminophenyl) 4-methylbenzenesulfonate has a molecular weight of 263.32 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminophenyl) 4-methylbenzenesulfonate is sourced from PubChem (CID 12636920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).