About 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride
2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride (PubChem CID 12636983) has the molecular formula C20H30ClNO3
and a molecular weight of 367.92 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride |
| PubChem CID | 12636983 |
| Molecular Formula | C20H30ClNO3 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride |
| SMILES | CCCCOc1ccc(/C=C/C(=O)OCCN2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C20H29NO3.ClH/c1-2-3-16-23-19-10-7-18(8-11-19)9-12-20(22)24-17-15-21-13-5-4-6-14-21;/h7-12H,2-6,13-17H2,1H3;1H/b12-9+; |
| InChIKey | WDBHEJYOODPZNC-NBYYMMLRSA-N |
| XLogP | 4.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride?
The IUPAC name of 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride (CID 12636983) is 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride.
What is the SMILES notation for 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride?
The canonical SMILES for 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride is CCCCOc1ccc(/C=C/C(=O)OCCN2CCCCC2)cc1.Cl.
What is the InChIKey of 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride?
The InChIKey is WDBHEJYOODPZNC-NBYYMMLRSA-N. The full InChI is InChI=1S/C20H29NO3.ClH/c1-2-3-16-23-19-10-7-18(8-11-19)9-12-20(22)24-17-15-21-13-5-4-6-14-21;/h7-12H,2-6,13-17H2,1H3;1H/b12-9+;.
What are the key properties of 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride?
2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride has a molecular weight of 367.92 g/mol, XLogP of 4.33, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl (E)-3-(4-butoxyphenyl)prop-2-enoate;hydrochloride is sourced from PubChem (CID 12636983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).