About 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate
2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate (PubChem CID 12637043) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 12637043 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OCC(O)CO |
| InChI | InChI=1S/C12H14O4/c13-8-11(14)9-16-12(15)7-6-10-4-2-1-3-5-10/h1-7,11,13-14H,8-9H2/b7-6+ |
| InChIKey | LECCRMLPHATJIB-VOTSOKGWSA-N |
| XLogP | 0.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate (CID 12637043) is 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate is O=C(/C=C/c1ccccc1)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate?
The InChIKey is LECCRMLPHATJIB-VOTSOKGWSA-N. The full InChI is InChI=1S/C12H14O4/c13-8-11(14)9-16-12(15)7-6-10-4-2-1-3-5-10/h1-7,11,13-14H,8-9H2/b7-6+.
What are the key properties of 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate?
2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate has a molecular weight of 222.24 g/mol, XLogP of 0.60, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 12637043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).