About 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene
14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene (PubChem CID 12637118) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene.
Molecular Properties
| Compound Name | 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene |
| PubChem CID | 12637118 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene |
| SMILES | c1nc2oc1CCCCCCCCC2 |
| InChI | InChI=1S/C12H19NO/c1-2-4-6-8-11-10-13-12(14-11)9-7-5-3-1/h10H,1-9H2 |
| InChIKey | DQUFASBRTWDPCS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene?
The IUPAC name of 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene (CID 12637118) is 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene.
What is the SMILES notation for 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene?
The canonical SMILES for 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene is c1nc2oc1CCCCCCCCC2.
What is the InChIKey of 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene?
The InChIKey is DQUFASBRTWDPCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-2-4-6-8-11-10-13-12(14-11)9-7-5-3-1/h10H,1-9H2.
What are the key properties of 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene?
14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene has a molecular weight of 193.29 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14-oxa-12-azabicyclo[9.2.1]tetradeca-1(13),11-diene is sourced from PubChem (CID 12637118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).